C15H10F2N2O3 — CID 51158962
(E)-N-(2,6-difluorophenyl)-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 51158962) has the molecular formula C15H10F2N2O3 and a molecular weight of 304.25 g/mol. Its IUPAC name is (E)-N-(2,6-difluorophenyl)-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2,6-difluorophenyl)-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51158962 |
| Molecular Formula | C15H10F2N2O3 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (E)-N-(2,6-difluorophenyl)-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H10F2N2O3/c16-11-5-3-6-12(17)15(11)18-14(20)9-8-10-4-1-2-7-13(10)19(21)22/h1-9H,(H,18,20)/b9-8+ |
| InChIKey | ITOBZLJURMDMNZ-CMDGGOBGSA-N |
| XLogP | 3.52 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|