C18H12N2O6 — CID 5382706
(5E)-1,6-bis(2-nitrophenyl)hexa-1,5-diene-3,4-dione (PubChem CID 5382706) has the molecular formula C18H12N2O6 and a molecular weight of 352.30 g/mol. Its IUPAC name is (5E)-1,6-bis(2-nitrophenyl)hexa-1,5-diene-3,4-dione.
| Compound Name | (5E)-1,6-bis(2-nitrophenyl)hexa-1,5-diene-3,4-dione |
|---|---|
| PubChem CID | 5382706 |
| Molecular Formula | C18H12N2O6 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (5E)-1,6-bis(2-nitrophenyl)hexa-1,5-diene-3,4-dione |
| SMILES | O=C(C=Cc1ccccc1[N+](=O)[O-])C(=O)/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N2O6/c21-17(11-9-13-5-1-3-7-15(13)19(23)24)18(22)12-10-14-6-2-4-8-16(14)20(25)26/h1-12H/b11-9+,12-10? |
| InChIKey | LDZOZIDZFFKDDX-IQYMAPIOSA-N |
| XLogP | 3.37 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|