C11H9NO4 — CID 92533335
(2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid (PubChem CID 92533335) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid.
| Compound Name | (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 92533335 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C\C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9NO4/c13-11(14)8-4-2-6-9-5-1-3-7-10(9)12(15)16/h1-8H,(H,13,14)/b6-2-,8-4- |
| InChIKey | IJXZQTLMGOOIAI-UIOOTCRHSA-N |
| XLogP | 2.25 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|