(2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid

C11H9NO4 — CID 92533335

IUPAC(2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid
SMILESO=C(O)/C=C\C=C/c1ccccc1[N+](=O)[O-]
InChIInChI=1S/C11H9NO4/c13-11(14)8-4-2-6-9-5-1-3-7-10(9)12(15)16/h1-8H,(H,13,14)/b6-2-,8-4-
InChIKeyIJXZQTLMGOOIAI-UIOOTCRHSA-N
MW219.20 g/mol
LogP2.25
Rot. Bonds4

About (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid

(2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid (PubChem CID 92533335) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid.

Molecular Properties

Compound Name(2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid
PubChem CID92533335
Molecular FormulaC11H9NO4
Molecular Weight219.20 g/mol
Exact Mass219.05
IUPAC Name(2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid
SMILESO=C(O)/C=C\C=C/c1ccccc1[N+](=O)[O-]
InChIInChI=1S/C11H9NO4/c13-11(14)8-4-2-6-9-5-1-3-7-10(9)12(15)16/h1-8H,(H,13,14)/b6-2-,8-4-
InChIKeyIJXZQTLMGOOIAI-UIOOTCRHSA-N
XLogP2.25
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid?
The IUPAC name of (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid (CID 92533335) is (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid.
What is the SMILES notation for (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid?
The canonical SMILES for (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid is O=C(O)/C=C\C=C/c1ccccc1[N+](=O)[O-].
What is the InChIKey of (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid?
The InChIKey is IJXZQTLMGOOIAI-UIOOTCRHSA-N. The full InChI is InChI=1S/C11H9NO4/c13-11(14)8-4-2-6-9-5-1-3-7-10(9)12(15)16/h1-8H,(H,13,14)/b6-2-,8-4-.
What are the key properties of (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid?
(2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid has a molecular weight of 219.20 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-5-(2-nitrophenyl)penta-2,4-dienoic acid is sourced from PubChem (CID 92533335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).