About 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate
2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 2543840) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate |
| PubChem CID | 2543840 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])OCCOc1ccccc1 |
| InChI | InChI=1S/C17H15NO5/c19-17(23-13-12-22-15-7-2-1-3-8-15)11-10-14-6-4-5-9-16(14)18(20)21/h1-11H,12-13H2/b11-10+ |
| InChIKey | RJOBQXLHDXSIOE-ZHACJKMWSA-N |
| XLogP | 3.23 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The IUPAC name of 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate (CID 2543840) is 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate.
What is the SMILES notation for 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The canonical SMILES for 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate is O=C(/C=C/c1ccccc1[N+](=O)[O-])OCCOc1ccccc1.
What is the InChIKey of 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The InChIKey is RJOBQXLHDXSIOE-ZHACJKMWSA-N. The full InChI is InChI=1S/C17H15NO5/c19-17(23-13-12-22-15-7-2-1-3-8-15)11-10-14-6-4-5-9-16(14)18(20)21/h1-11H,12-13H2/b11-10+.
What are the key properties of 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate?
2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate has a molecular weight of 313.31 g/mol, XLogP of 3.23, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyethyl (E)-3-(2-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 2543840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).