About (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate
(2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 8605194) has the molecular formula C18H17NO5
and a molecular weight of 327.34 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate |
| PubChem CID | 8605194 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | CCOc1ccccc1COC(=O)/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17NO5/c1-2-23-17-10-6-4-8-15(17)13-24-18(20)12-11-14-7-3-5-9-16(14)19(21)22/h3-12H,2,13H2,1H3/b12-11+ |
| InChIKey | MGBYWXGJPKYQRG-VAWYXSNFSA-N |
| XLogP | 3.75 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The IUPAC name of (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate (CID 8605194) is (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate.
What is the SMILES notation for (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The canonical SMILES for (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate is CCOc1ccccc1COC(=O)/C=C/c1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate?
The InChIKey is MGBYWXGJPKYQRG-VAWYXSNFSA-N. The full InChI is InChI=1S/C18H17NO5/c1-2-23-17-10-6-4-8-15(17)13-24-18(20)12-11-14-7-3-5-9-16(14)19(21)22/h3-12H,2,13H2,1H3/b12-11+.
What are the key properties of (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate?
(2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate has a molecular weight of 327.34 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxyphenyl)methyl (E)-3-(2-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 8605194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).