About (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide
(E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide (PubChem CID 30769477) has the molecular formula C11H11N3O4
and a molecular weight of 249.23 g/mol. Its IUPAC name is (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide |
| PubChem CID | 30769477 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide |
| SMILES | CC(=O)NNC(=O)/C=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O4/c1-8(15)12-13-11(16)7-6-9-4-2-3-5-10(9)14(17)18/h2-7H,1H3,(H,12,15)(H,13,16)/b7-6+ |
| InChIKey | ZVWXFYOQNIRLII-VOTSOKGWSA-N |
| XLogP | 0.78 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide?
The IUPAC name of (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide (CID 30769477) is (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide.
What is the SMILES notation for (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide?
The canonical SMILES for (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide is CC(=O)NNC(=O)/C=C/c1ccccc1[N+](=O)[O-].
What is the InChIKey of (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide?
The InChIKey is ZVWXFYOQNIRLII-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H11N3O4/c1-8(15)12-13-11(16)7-6-9-4-2-3-5-10(9)14(17)18/h2-7H,1H3,(H,12,15)(H,13,16)/b7-6+.
What are the key properties of (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide?
(E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide has a molecular weight of 249.23 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-acetyl-3-(2-nitrophenyl)prop-2-enehydrazide is sourced from PubChem (CID 30769477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).