C15H18N2O4 — CID 43389284
(E)-N-(4-hydroxycyclohexyl)-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 43389284) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is (E)-N-(4-hydroxycyclohexyl)-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-hydroxycyclohexyl)-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43389284 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (E)-N-(4-hydroxycyclohexyl)-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])NC1CCC(O)CC1 |
| InChI | InChI=1S/C15H18N2O4/c18-13-8-6-12(7-9-13)16-15(19)10-5-11-3-1-2-4-14(11)17(20)21/h1-5,10,12-13,18H,6-9H2,(H,16,19)/b10-5+ |
| InChIKey | JCCVWVVXWNYJFT-BJMVGYQFSA-N |
| XLogP | 2.03 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|