C16H20N2O4 — CID 111460122
(E)-N-[(3-hydroxycyclohexyl)methyl]-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 111460122) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (E)-N-[(3-hydroxycyclohexyl)methyl]-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3-hydroxycyclohexyl)methyl]-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 111460122 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (E)-N-[(3-hydroxycyclohexyl)methyl]-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])NCC1CCCC(O)C1 |
| InChI | InChI=1S/C16H20N2O4/c19-14-6-3-4-12(10-14)11-17-16(20)9-8-13-5-1-2-7-15(13)18(21)22/h1-2,5,7-9,12,14,19H,3-4,6,10-11H2,(H,17,20)/b9-8+ |
| InChIKey | MZPBGECDAQNBGO-CMDGGOBGSA-N |
| XLogP | 2.28 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|