C20H15NO4S2 — CID 1032631
(E)-2-(1,3-dithiolan-2-ylidene)-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione (PubChem CID 1032631) has the molecular formula C20H15NO4S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (E)-2-(1,3-dithiolan-2-ylidene)-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione.
| Compound Name | (E)-2-(1,3-dithiolan-2-ylidene)-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 1032631 |
| Molecular Formula | C20H15NO4S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (E)-2-(1,3-dithiolan-2-ylidene)-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])C(C(=O)c1ccccc1)=C1SCCS1 |
| InChI | InChI=1S/C20H15NO4S2/c22-17(11-10-14-6-4-5-9-16(14)21(24)25)18(20-26-12-13-27-20)19(23)15-7-2-1-3-8-15/h1-11H,12-13H2/b11-10+ |
| InChIKey | SDOGYIANWSEDSO-ZHACJKMWSA-N |
| XLogP | 4.75 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|