C21H17NO4S2 — CID 99902660
(Z,2E)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione (PubChem CID 99902660) has the molecular formula C21H17NO4S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is (Z,2E)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione.
| Compound Name | (Z,2E)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 99902660 |
| Molecular Formula | C21H17NO4S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (Z,2E)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-5-(2-nitrophenyl)-1-phenylpent-4-ene-1,3-dione |
| SMILES | C[C@@H]1CS/C(=C(/C(=O)/C=C\c2ccccc2[N+](=O)[O-])C(=O)c2ccccc2)S1 |
| InChI | InChI=1S/C21H17NO4S2/c1-14-13-27-21(28-14)19(20(24)16-8-3-2-4-9-16)18(23)12-11-15-7-5-6-10-17(15)22(25)26/h2-12,14H,13H2,1H3/b12-11-,21-19+/t14-/m1/s1 |
| InChIKey | RKHIVJYDHLWLQT-FAYIHMLCSA-N |
| XLogP | 5.14 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|