C12H13NO2S2 — CID 51708039
(2S,4R)-4-methyl-2-[(E)-2-(2-nitrophenyl)ethenyl]-1,3-dithiolane (PubChem CID 51708039) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is (2S,4R)-4-methyl-2-[(E)-2-(2-nitrophenyl)ethenyl]-1,3-dithiolane.
| Compound Name | (2S,4R)-4-methyl-2-[(E)-2-(2-nitrophenyl)ethenyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 51708039 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | (2S,4R)-4-methyl-2-[(E)-2-(2-nitrophenyl)ethenyl]-1,3-dithiolane |
| SMILES | C[C@@H]1CS[C@H](/C=C/c2ccccc2[N+](=O)[O-])S1 |
| InChI | InChI=1S/C12H13NO2S2/c1-9-8-16-12(17-9)7-6-10-4-2-3-5-11(10)13(14)15/h2-7,9,12H,8H2,1H3/b7-6+/t9-,12+/m1/s1 |
| InChIKey | FSFJFWRVPPIIFR-VACNFSINSA-N |
| XLogP | 3.80 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|