C16H23N2O2+ — CID 7445086
(3S,5R)-3,5-dimethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidin-1-ium (PubChem CID 7445086) has the molecular formula C16H23N2O2+ and a molecular weight of 275.37 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidin-1-ium.
| Compound Name | (3S,5R)-3,5-dimethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7445086 |
| Molecular Formula | C16H23N2O2+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-1-[(E)-3-(2-nitrophenyl)prop-2-enyl]piperidin-1-ium |
| SMILES | C[C@@H]1C[C@H](C)C[NH+](C/C=C/c2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H22N2O2/c1-13-10-14(2)12-17(11-13)9-5-7-15-6-3-4-8-16(15)18(19)20/h3-8,13-14H,9-12H2,1-2H3/p+1/b7-5+/t13-,14+ |
| InChIKey | MLIFNSQYMKISJW-CCSSQEOUSA-O |
| XLogP | 2.17 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|