C15H15NO6 — CID 24807027
2,2-dimethyl-5-[(E)-3-(2-nitrophenyl)prop-2-enyl]-1,3-dioxane-4,6-dione (PubChem CID 24807027) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(E)-3-(2-nitrophenyl)prop-2-enyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(E)-3-(2-nitrophenyl)prop-2-enyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 24807027 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2,2-dimethyl-5-[(E)-3-(2-nitrophenyl)prop-2-enyl]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C/C=C/c2ccccc2[N+](=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C15H15NO6/c1-15(2)21-13(17)11(14(18)22-15)8-5-7-10-6-3-4-9-12(10)16(19)20/h3-7,9,11H,8H2,1-2H3/b7-5+ |
| InChIKey | JNBRJMYEMGTKHN-FNORWQNLSA-N |
| XLogP | 2.45 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|