C12H13NO4 — CID 67020081
2-methyl-2-[2-(2-nitrophenyl)ethenyl]-1,3-dioxolane (PubChem CID 67020081) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-methyl-2-[2-(2-nitrophenyl)ethenyl]-1,3-dioxolane.
| Compound Name | 2-methyl-2-[2-(2-nitrophenyl)ethenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 67020081 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-methyl-2-[2-(2-nitrophenyl)ethenyl]-1,3-dioxolane |
| SMILES | CC1(C=Cc2ccccc2[N+](=O)[O-])OCCO1 |
| InChI | InChI=1S/C12H13NO4/c1-12(16-8-9-17-12)7-6-10-4-2-3-5-11(10)13(14)15/h2-7H,8-9H2,1H3 |
| InChIKey | UXFFFOUEIIGBFO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|