C12H22N4O2 — CID 91001187
(E)-N,N-dimethyl-2-(2-nitrophenyl)ethenamine;ethane;hydrazine (PubChem CID 91001187) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (E)-N,N-dimethyl-2-(2-nitrophenyl)ethenamine;ethane;hydrazine.
| Compound Name | (E)-N,N-dimethyl-2-(2-nitrophenyl)ethenamine;ethane;hydrazine |
|---|---|
| PubChem CID | 91001187 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (E)-N,N-dimethyl-2-(2-nitrophenyl)ethenamine;ethane;hydrazine |
| SMILES | CC.CN(C)/C=C/c1ccccc1[N+](=O)[O-].NN |
| InChI | InChI=1S/C10H12N2O2.C2H6.H4N2/c1-11(2)8-7-9-5-3-4-6-10(9)12(13)14;2*1-2/h3-8H,1-2H3;1-2H3;1-2H2/b8-7+;; |
| InChIKey | VYDVIAVBCPDFQL-MIIBGCIDSA-N |
| XLogP | 1.97 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|