C15H15N3O3 — CID 87240394
(E)-N,N-dimethyl-2-(5-nitro-2-phenoxy-4-pyridinyl)ethenamine (PubChem CID 87240394) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (E)-N,N-dimethyl-2-(5-nitro-2-phenoxy-4-pyridinyl)ethenamine.
| Compound Name | (E)-N,N-dimethyl-2-(5-nitro-2-phenoxy-4-pyridinyl)ethenamine |
|---|---|
| PubChem CID | 87240394 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (E)-N,N-dimethyl-2-(5-nitro-2-phenoxy-4-pyridinyl)ethenamine |
| SMILES | CN(C)/C=C/c1cc(Oc2ccccc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N3O3/c1-17(2)9-8-12-10-15(16-11-14(12)18(19)20)21-13-6-4-3-5-7-13/h3-11H,1-2H3/b9-8+ |
| InChIKey | BBYFMVBJQSOCFM-CMDGGOBGSA-N |
| XLogP | 3.31 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|