C17H12N2O4 — CID 139217922
5-nitro-2,4-diphenoxypyridine (PubChem CID 139217922) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 5-nitro-2,4-diphenoxypyridine.
| Compound Name | 5-nitro-2,4-diphenoxypyridine |
|---|---|
| PubChem CID | 139217922 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-nitro-2,4-diphenoxypyridine |
| SMILES | O=[N+]([O-])c1cnc(Oc2ccccc2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C17H12N2O4/c20-19(21)15-12-18-17(23-14-9-5-2-6-10-14)11-16(15)22-13-7-3-1-4-8-13/h1-12H |
| InChIKey | COJSJXNOENTROG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|