About (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine
(E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine (PubChem CID 22165970) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine.
Molecular Properties
| Compound Name | (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine |
| PubChem CID | 22165970 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine |
| SMILES | CN(C)/C=C/c1ccc([N+](=O)[O-])c2[nH]ncc12 |
| InChI | InChI=1S/C11H12N4O2/c1-14(2)6-5-8-3-4-10(15(16)17)11-9(8)7-12-13-11/h3-7H,1-2H3,(H,12,13)/b6-5+ |
| InChIKey | MZCMXIMDEXSRMO-AATRIKPKSA-N |
| XLogP | 2.00 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine?
The IUPAC name of (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine (CID 22165970) is (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine.
What is the SMILES notation for (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine?
The canonical SMILES for (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine is CN(C)/C=C/c1ccc([N+](=O)[O-])c2[nH]ncc12.
What is the InChIKey of (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine?
The InChIKey is MZCMXIMDEXSRMO-AATRIKPKSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-14(2)6-5-8-3-4-10(15(16)17)11-9(8)7-12-13-11/h3-7H,1-2H3,(H,12,13)/b6-5+.
What are the key properties of (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine?
(E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine has a molecular weight of 232.24 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-2-(7-nitro-1H-indazol-4-yl)ethenamine is sourced from PubChem (CID 22165970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).