C11H14N2O2 — CID 123915141
N,N-dimethyl-2-(2-methyl-5-nitrophenyl)ethenamine (PubChem CID 123915141) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-methyl-5-nitrophenyl)ethenamine.
| Compound Name | N,N-dimethyl-2-(2-methyl-5-nitrophenyl)ethenamine |
|---|---|
| PubChem CID | 123915141 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N,N-dimethyl-2-(2-methyl-5-nitrophenyl)ethenamine |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C=CN(C)C |
| InChI | InChI=1S/C11H14N2O2/c1-9-4-5-11(13(14)15)8-10(9)6-7-12(2)3/h4-8H,1-3H3 |
| InChIKey | GXYBWFICICRBTL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|