C10H11ClN2O2 — CID 11310699
(E)-2-(2-chloro-4-nitrophenyl)-N,N-dimethylethenamine (PubChem CID 11310699) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is (E)-2-(2-chloro-4-nitrophenyl)-N,N-dimethylethenamine.
| Compound Name | (E)-2-(2-chloro-4-nitrophenyl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 11310699 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (E)-2-(2-chloro-4-nitrophenyl)-N,N-dimethylethenamine |
| SMILES | CN(C)/C=C/c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H11ClN2O2/c1-12(2)6-5-8-3-4-9(13(14)15)7-10(8)11/h3-7H,1-2H3/b6-5+ |
| InChIKey | XFDOABBRZKPSAF-AATRIKPKSA-N |
| XLogP | 2.78 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|