C10H10Cl2N2O2 — CID 10563333
(E)-2-(2,5-dichloro-4-nitrophenyl)-N,N-dimethylethenamine (PubChem CID 10563333) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is (E)-2-(2,5-dichloro-4-nitrophenyl)-N,N-dimethylethenamine.
| Compound Name | (E)-2-(2,5-dichloro-4-nitrophenyl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 10563333 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (E)-2-(2,5-dichloro-4-nitrophenyl)-N,N-dimethylethenamine |
| SMILES | CN(C)/C=C/c1cc(Cl)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-13(2)4-3-7-5-9(12)10(14(15)16)6-8(7)11/h3-6H,1-2H3/b4-3+ |
| InChIKey | DAKURRGFZFTSOS-ONEGZZNKSA-N |
| XLogP | 3.43 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|