C23H31ClN6O10 — CID 161393546
(E)-2-(5-chloro-2,4-dinitrophenyl)-N,N-dimethylethenamine;1,1-dimethoxy-N,N-dimethylmethanamine;1,5-dimethyl-2,4-dinitrobenzene (PubChem CID 161393546) has the molecular formula C23H31ClN6O10 and a molecular weight of 586.99 g/mol. Its IUPAC name is (E)-2-(5-chloro-2,4-dinitrophenyl)-N,N-dimethylethenamine;1,1-dimethoxy-N,N-dimethylmethanamine;1,5-dimethyl-2,4-dinitrobenzene.
| Compound Name | (E)-2-(5-chloro-2,4-dinitrophenyl)-N,N-dimethylethenamine;1,1-dimethoxy-N,N-dimethylmethanamine;1,5-dimethyl-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 161393546 |
| Molecular Formula | C23H31ClN6O10 |
| Molecular Weight | 586.99 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | (E)-2-(5-chloro-2,4-dinitrophenyl)-N,N-dimethylethenamine;1,1-dimethoxy-N,N-dimethylmethanamine;1,5-dimethyl-2,4-dinitrobenzene |
| SMILES | CN(C)/C=C/c1cc(Cl)c([N+](=O)[O-])cc1[N+](=O)[O-].COC(OC)N(C)C.Cc1cc(C)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10ClN3O4.C8H8N2O4.C5H13NO2/c1-12(2)4-3-7-5-8(11)10(14(17)18)6-9(7)13(15)16;1-5-3-6(2)8(10(13)14)4-7(5)9(11)12;1-6(2)5(7-3)8-4/h3-6H,1-2H3;3-4H,1-2H3;5H,1-4H3/b4-3+;; |
| InChIKey | VTHMNMWUSAOKHJ-CZEFNJPISA-N |
| XLogP | 4.93 |
| TPSA | 197.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|