C26H36Br2F2N4O6 — CID 161336250
1-bromo-2-fluoro-4-methyl-5-nitrobenzene;(E)-2-(4-bromo-5-fluoro-2-nitrophenyl)-N,N-dimethylethenamine;N,N-dimethyl-1,1-di(propan-2-yloxy)methanamine (PubChem CID 161336250) has the molecular formula C26H36Br2F2N4O6 and a molecular weight of 698.40 g/mol. Its IUPAC name is 1-bromo-2-fluoro-4-methyl-5-nitrobenzene;(E)-2-(4-bromo-5-fluoro-2-nitrophenyl)-N,N-dimethylethenamine;N,N-dimethyl-1,1-di(propan-2-yloxy)methanamine.
| Compound Name | 1-bromo-2-fluoro-4-methyl-5-nitrobenzene;(E)-2-(4-bromo-5-fluoro-2-nitrophenyl)-N,N-dimethylethenamine;N,N-dimethyl-1,1-di(propan-2-yloxy)methanamine |
|---|---|
| PubChem CID | 161336250 |
| Molecular Formula | C26H36Br2F2N4O6 |
| Molecular Weight | 698.40 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | 1-bromo-2-fluoro-4-methyl-5-nitrobenzene;(E)-2-(4-bromo-5-fluoro-2-nitrophenyl)-N,N-dimethylethenamine;N,N-dimethyl-1,1-di(propan-2-yloxy)methanamine |
| SMILES | CC(C)OC(OC(C)C)N(C)C.CN(C)/C=C/c1cc(F)c(Br)cc1[N+](=O)[O-].Cc1cc(F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10BrFN2O2.C9H21NO2.C7H5BrFNO2/c1-13(2)4-3-7-5-9(12)8(11)6-10(7)14(15)16;1-7(2)11-9(10(5)6)12-8(3)4;1-4-2-6(9)5(8)3-7(4)10(11)12/h3-6H,1-2H3;7-9H,1-6H3;2-3H,1H3/b4-3+;; |
| InChIKey | VMBOPXHSJXOPSA-CZEFNJPISA-N |
| XLogP | 7.52 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.40 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|