methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate

C10H7Cl2NO4 — CID 54411754

IUPACmethyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate
SMILESCOC(=O)C=Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-]
InChIInChI=1S/C10H7Cl2NO4/c1-17-10(14)3-2-6-4-7(11)8(12)5-9(6)13(15)16/h2-5H,1H3
InChIKeyVUPYNMFJLWNCJH-UHFFFAOYSA-N
MW276.08 g/mol
LogP3.09
Rot. Bonds3

About methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate

methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate (PubChem CID 54411754) has the molecular formula C10H7Cl2NO4 and a molecular weight of 276.08 g/mol. Its IUPAC name is methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate.

Molecular Properties

Compound Namemethyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate
PubChem CID54411754
Molecular FormulaC10H7Cl2NO4
Molecular Weight276.08 g/mol
Exact Mass274.98
IUPAC Namemethyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate
SMILESCOC(=O)C=Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-]
InChIInChI=1S/C10H7Cl2NO4/c1-17-10(14)3-2-6-4-7(11)8(12)5-9(6)13(15)16/h2-5H,1H3
InChIKeyVUPYNMFJLWNCJH-UHFFFAOYSA-N
XLogP3.09
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.08
LogP ≤ 53.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate?
The IUPAC name of methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate (CID 54411754) is methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate.
What is the SMILES notation for methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate?
The canonical SMILES for methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate is COC(=O)C=Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-].
What is the InChIKey of methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate?
The InChIKey is VUPYNMFJLWNCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO4/c1-17-10(14)3-2-6-4-7(11)8(12)5-9(6)13(15)16/h2-5H,1H3.
What are the key properties of methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate?
methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate has a molecular weight of 276.08 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate is sourced from PubChem (CID 54411754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).