C10H7Cl2NO4 — CID 54411754
methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate (PubChem CID 54411754) has the molecular formula C10H7Cl2NO4 and a molecular weight of 276.08 g/mol. Its IUPAC name is methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate.
| Compound Name | methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 54411754 |
| Molecular Formula | C10H7Cl2NO4 |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | methyl 3-(4,5-dichloro-2-nitrophenyl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7Cl2NO4/c1-17-10(14)3-2-6-4-7(11)8(12)5-9(6)13(15)16/h2-5H,1H3 |
| InChIKey | VUPYNMFJLWNCJH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|