C16H11Cl2NO5 — CID 19594562
methyl (E)-3-[4-(2,4-dichlorophenoxy)-3-nitrophenyl]prop-2-enoate (PubChem CID 19594562) has the molecular formula C16H11Cl2NO5 and a molecular weight of 368.17 g/mol. Its IUPAC name is methyl (E)-3-[4-(2,4-dichlorophenoxy)-3-nitrophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(2,4-dichlorophenoxy)-3-nitrophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19594562 |
| Molecular Formula | C16H11Cl2NO5 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | methyl (E)-3-[4-(2,4-dichlorophenoxy)-3-nitrophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(Oc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11Cl2NO5/c1-23-16(20)7-3-10-2-5-15(13(8-10)19(21)22)24-14-6-4-11(17)9-12(14)18/h2-9H,1H3/b7-3+ |
| InChIKey | JKAQJWBRJCGNEB-XVNBXDOJSA-N |
| XLogP | 4.88 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|