C24H24N4O8 — CID 55570134
methyl (E)-3-[4-[4-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]-2-nitrophenyl]piperazin-1-yl]-3-nitrophenyl]prop-2-enoate (PubChem CID 55570134) has the molecular formula C24H24N4O8 and a molecular weight of 496.48 g/mol. Its IUPAC name is methyl (E)-3-[4-[4-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]-2-nitrophenyl]piperazin-1-yl]-3-nitrophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[4-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]-2-nitrophenyl]piperazin-1-yl]-3-nitrophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55570134 |
| Molecular Formula | C24H24N4O8 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | methyl (E)-3-[4-[4-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]-2-nitrophenyl]piperazin-1-yl]-3-nitrophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(N2CCN(c3ccc(/C=C/C(=O)OC)cc3[N+](=O)[O-])CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24N4O8/c1-35-23(29)9-5-17-3-7-19(21(15-17)27(31)32)25-11-13-26(14-12-25)20-8-4-18(6-10-24(30)36-2)16-22(20)28(33)34/h3-10,15-16H,11-14H2,1-2H3/b9-5+,10-6+ |
| InChIKey | IBHPKLMOUXAOEH-NXZHAISVSA-N |
| XLogP | 3.20 |
| TPSA | 145.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|