C13H15N3O3 — CID 170876700
(E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enamide (PubChem CID 170876700) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 170876700 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N3O3/c14-13(17)6-4-10-3-5-11(12(9-10)16(18)19)15-7-1-2-8-15/h3-6,9H,1-2,7-8H2,(H2,14,17)/b6-4+ |
| InChIKey | KWOZZILTBMMDKH-GQCTYLIASA-N |
| XLogP | 1.69 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|