C19H17Cl2N3O4 — CID 40784088
[(E)-(3-nitro-4-piperidin-1-ylphenyl)methylideneamino] 2,4-dichlorobenzoate (PubChem CID 40784088) has the molecular formula C19H17Cl2N3O4 and a molecular weight of 422.27 g/mol. Its IUPAC name is [(E)-(3-nitro-4-piperidin-1-ylphenyl)methylideneamino] 2,4-dichlorobenzoate.
| Compound Name | [(E)-(3-nitro-4-piperidin-1-ylphenyl)methylideneamino] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 40784088 |
| Molecular Formula | C19H17Cl2N3O4 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | [(E)-(3-nitro-4-piperidin-1-ylphenyl)methylideneamino] 2,4-dichlorobenzoate |
| SMILES | O=C(O/N=C/c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N3O4/c20-14-5-6-15(16(21)11-14)19(25)28-22-12-13-4-7-17(18(10-13)24(26)27)23-8-2-1-3-9-23/h4-7,10-12H,1-3,8-9H2/b22-12+ |
| InChIKey | MLQFPSXUTRRBMB-WSDLNYQXSA-N |
| XLogP | 5.08 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|