C16H20N6O2 — CID 3618069
N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-piperidin-1-ylphenyl)methanimine (PubChem CID 3618069) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-piperidin-1-ylphenyl)methanimine.
| Compound Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-piperidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 3618069 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-(3,5-dimethyl-1,2,4-triazol-4-yl)-1-(3-nitro-4-piperidin-1-ylphenyl)methanimine |
| SMILES | Cc1nnc(C)n1N=Cc1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H20N6O2/c1-12-18-19-13(2)21(12)17-11-14-6-7-15(16(10-14)22(23)24)20-8-4-3-5-9-20/h6-7,10-11H,3-5,8-9H2,1-2H3 |
| InChIKey | PLJWUFHSZCZKHU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|