C16H20N6O2 — CID 168630983
4-methyl-1-[(3-nitro-4-piperidin-1-ylphenyl)methylideneamino]imidazol-2-amine (PubChem CID 168630983) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-methyl-1-[(3-nitro-4-piperidin-1-ylphenyl)methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[(3-nitro-4-piperidin-1-ylphenyl)methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168630983 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-methyl-1-[(3-nitro-4-piperidin-1-ylphenyl)methylideneamino]imidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(N3CCCCC3)c([N+](=O)[O-])c2)c(N)n1 |
| InChI | InChI=1S/C16H20N6O2/c1-12-11-21(16(17)19-12)18-10-13-5-6-14(15(9-13)22(23)24)20-7-3-2-4-8-20/h5-6,9-11H,2-4,7-8H2,1H3,(H2,17,19) |
| InChIKey | FBARIKZIOLJEMB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|