C17H15N5O3 — CID 168629881
4-methyl-1-[[2-(2-nitrophenoxy)phenyl]methylideneamino]imidazol-2-amine (PubChem CID 168629881) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-methyl-1-[[2-(2-nitrophenoxy)phenyl]methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[[2-(2-nitrophenoxy)phenyl]methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168629881 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-methyl-1-[[2-(2-nitrophenoxy)phenyl]methylideneamino]imidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccccc2Oc2ccccc2[N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C17H15N5O3/c1-12-11-21(17(18)20-12)19-10-13-6-2-4-8-15(13)25-16-9-5-3-7-14(16)22(23)24/h2-11H,1H3,(H2,18,20) |
| InChIKey | HWIZTJCVYKWHFB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|