C11H10F2N4 — CID 168628497
1-[(2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168628497) has the molecular formula C11H10F2N4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168628497 |
| Molecular Formula | C11H10F2N4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(F)cc2F)c(N)n1 |
| InChI | InChI=1S/C11H10F2N4/c1-7-6-17(11(14)16-7)15-5-8-2-3-9(12)4-10(8)13/h2-6H,1H3,(H2,14,16) |
| InChIKey | YNQVIUNHRYCQQI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|