C11H9ClF2N4 — CID 168628790
1-[(3-chloro-2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168628790) has the molecular formula C11H9ClF2N4 and a molecular weight of 270.67 g/mol. Its IUPAC name is 1-[(3-chloro-2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(3-chloro-2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168628790 |
| Molecular Formula | C11H9ClF2N4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-[(3-chloro-2,4-difluorophenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(F)c(Cl)c2F)c(N)n1 |
| InChI | InChI=1S/C11H9ClF2N4/c1-6-5-18(11(15)17-6)16-4-7-2-3-8(13)9(12)10(7)14/h2-5H,1H3,(H2,15,17) |
| InChIKey | PZBRGVNZORQUBV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|