C13H11ClN6 — CID 168631298
1-[(4-chloroquinazolin-6-yl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168631298) has the molecular formula C13H11ClN6 and a molecular weight of 286.73 g/mol. Its IUPAC name is 1-[(4-chloroquinazolin-6-yl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(4-chloroquinazolin-6-yl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168631298 |
| Molecular Formula | C13H11ClN6 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-[(4-chloroquinazolin-6-yl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc3ncnc(Cl)c3c2)c(N)n1 |
| InChI | InChI=1S/C13H11ClN6/c1-8-6-20(13(15)19-8)18-5-9-2-3-11-10(4-9)12(14)17-7-16-11/h2-7H,1H3,(H2,15,19) |
| InChIKey | ZKLBSLIUJFQUJK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|