C20H20Cl2N4O2 — CID 168630181
1-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168630181) has the molecular formula C20H20Cl2N4O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is 1-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168630181 |
| Molecular Formula | C20H20Cl2N4O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-[[4-[(2,6-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | CCOc1cc(C=Nn2cc(C)nc2N)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H20Cl2N4O2/c1-3-27-19-9-14(10-24-26-11-13(2)25-20(26)23)7-8-18(19)28-12-15-16(21)5-4-6-17(15)22/h4-11H,3,12H2,1-2H3,(H2,23,25) |
| InChIKey | SYIYHPXRZPDLAD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|