C21H25ClFN3O2 — CID 42995005
(E)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylpiperazin-1-yl)methanimine (PubChem CID 42995005) has the molecular formula C21H25ClFN3O2 and a molecular weight of 405.90 g/mol. Its IUPAC name is (E)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylpiperazin-1-yl)methanimine.
| Compound Name | (E)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylpiperazin-1-yl)methanimine |
|---|---|
| PubChem CID | 42995005 |
| Molecular Formula | C21H25ClFN3O2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (E)-1-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxyphenyl]-N-(4-methylpiperazin-1-yl)methanimine |
| SMILES | CCOc1cc(/C=N/N2CCN(C)CC2)ccc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C21H25ClFN3O2/c1-3-27-21-13-16(14-24-26-11-9-25(2)10-12-26)7-8-20(21)28-15-17-18(22)5-4-6-19(17)23/h4-8,13-14H,3,9-12,15H2,1-2H3/b24-14+ |
| InChIKey | HCRLOHRWSFGRPK-ZVHZXABRSA-N |
| XLogP | 4.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|