C16H14ClFO4 — CID 22685655
4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxybenzoic acid (PubChem CID 22685655) has the molecular formula C16H14ClFO4 and a molecular weight of 324.74 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxybenzoic acid.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 22685655 |
| Molecular Formula | C16H14ClFO4 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methoxy]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H14ClFO4/c1-2-21-15-8-10(16(19)20)6-7-14(15)22-9-11-12(17)4-3-5-13(11)18/h3-8H,2,9H2,1H3,(H,19,20) |
| InChIKey | RIEPPTQAIIDKKU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |