C16H15ClO4 — CID 4769645
4-[(2-chlorophenyl)methoxy]-3-ethoxybenzoic acid (PubChem CID 4769645) has the molecular formula C16H15ClO4 and a molecular weight of 306.75 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methoxy]-3-ethoxybenzoic acid.
| Compound Name | 4-[(2-chlorophenyl)methoxy]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 4769645 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-[(2-chlorophenyl)methoxy]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C16H15ClO4/c1-2-20-15-9-11(16(18)19)7-8-14(15)21-10-12-5-3-4-6-13(12)17/h3-9H,2,10H2,1H3,(H,18,19) |
| InChIKey | SUYBJCRUPCWYRM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |