C15H18N4O4 — CID 168629904
methyl 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetate (PubChem CID 168629904) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168629904 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | methyl 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C=Nn2cc(C)nc2N)cc1OC |
| InChI | InChI=1S/C15H18N4O4/c1-10-8-19(15(16)18-10)17-7-11-4-5-12(13(6-11)21-2)23-9-14(20)22-3/h4-8H,9H2,1-3H3,(H2,16,18) |
| InChIKey | OCFATGOSCNDYGJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|