C18H25N5O3 — CID 168630145
2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]-N,N-diethylacetamide (PubChem CID 168630145) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 168630145 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-methoxyphenoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(C=Nn2cc(C)nc2N)cc1OC |
| InChI | InChI=1S/C18H25N5O3/c1-5-22(6-2)17(24)12-26-15-8-7-14(9-16(15)25-4)10-20-23-11-13(3)21-18(23)19/h7-11H,5-6,12H2,1-4H3,(H2,19,21) |
| InChIKey | OKFNBIJZFDTZFB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|