C18H22N6O2 — CID 168630138
1-[[3-ethoxy-4-(2-imidazol-1-ylethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168630138) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[[3-ethoxy-4-(2-imidazol-1-ylethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[3-ethoxy-4-(2-imidazol-1-ylethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168630138 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[[3-ethoxy-4-(2-imidazol-1-ylethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | CCOc1cc(C=Nn2cc(C)nc2N)ccc1OCCn1ccnc1 |
| InChI | InChI=1S/C18H22N6O2/c1-3-25-17-10-15(11-21-24-12-14(2)22-18(24)19)4-5-16(17)26-9-8-23-7-6-20-13-23/h4-7,10-13H,3,8-9H2,1-2H3,(H2,19,22) |
| InChIKey | OBKOQFVMDCLQTI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|