C14H17IN4O2 — CID 168630518
1-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168630518) has the molecular formula C14H17IN4O2 and a molecular weight of 400.22 g/mol. Its IUPAC name is 1-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168630518 |
| Molecular Formula | C14H17IN4O2 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-[(3-ethoxy-5-iodo-4-methoxyphenyl)methylideneamino]-4-methylimidazol-2-amine |
| SMILES | CCOc1cc(C=Nn2cc(C)nc2N)cc(I)c1OC |
| InChI | InChI=1S/C14H17IN4O2/c1-4-21-12-6-10(5-11(15)13(12)20-3)7-17-19-8-9(2)18-14(19)16/h5-8H,4H2,1-3H3,(H2,16,18) |
| InChIKey | MEOQGKIYMWRTBP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|