C19H17IN4O3 — CID 168630514
[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-iodo-6-methoxyphenyl] benzoate (PubChem CID 168630514) has the molecular formula C19H17IN4O3 and a molecular weight of 476.27 g/mol. Its IUPAC name is [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-iodo-6-methoxyphenyl] benzoate.
| Compound Name | [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-iodo-6-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 168630514 |
| Molecular Formula | C19H17IN4O3 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-2-iodo-6-methoxyphenyl] benzoate |
| SMILES | COc1cc(C=Nn2cc(C)nc2N)cc(I)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17IN4O3/c1-12-11-24(19(21)23-12)22-10-13-8-15(20)17(16(9-13)26-2)27-18(25)14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,21,23) |
| InChIKey | HPNPWOBEPTZGAS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|