C13H12BrF3N4O — CID 168630950
1-[[3-bromo-4-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168630950) has the molecular formula C13H12BrF3N4O and a molecular weight of 377.16 g/mol. Its IUPAC name is 1-[[3-bromo-4-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[3-bromo-4-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168630950 |
| Molecular Formula | C13H12BrF3N4O |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 1-[[3-bromo-4-methoxy-5-(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | COc1c(Br)cc(C=Nn2cc(C)nc2N)cc1C(F)(F)F |
| InChI | InChI=1S/C13H12BrF3N4O/c1-7-6-21(12(18)20-7)19-5-8-3-9(13(15,16)17)11(22-2)10(14)4-8/h3-6H,1-2H3,(H2,18,20) |
| InChIKey | MEBTUEGOKWEKDU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|