C12H10BrF3N4O — CID 168631150
1-[[4-bromo-3-(trifluoromethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168631150) has the molecular formula C12H10BrF3N4O and a molecular weight of 363.14 g/mol. Its IUPAC name is 1-[[4-bromo-3-(trifluoromethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[4-bromo-3-(trifluoromethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168631150 |
| Molecular Formula | C12H10BrF3N4O |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 1-[[4-bromo-3-(trifluoromethoxy)phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(Br)c(OC(F)(F)F)c2)c(N)n1 |
| InChI | InChI=1S/C12H10BrF3N4O/c1-7-6-20(11(17)19-7)18-5-8-2-3-9(13)10(4-8)21-12(14,15)16/h2-6H,1H3,(H2,17,19) |
| InChIKey | DTEOALICAFYPNM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|