C13H10F6N4 — CID 168628714
1-[[2,4-bis(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168628714) has the molecular formula C13H10F6N4 and a molecular weight of 336.24 g/mol. Its IUPAC name is 1-[[2,4-bis(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168628714 |
| Molecular Formula | C13H10F6N4 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-[[2,4-bis(trifluoromethyl)phenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(C(F)(F)F)cc2C(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C13H10F6N4/c1-7-6-23(11(20)22-7)21-5-8-2-3-9(12(14,15)16)4-10(8)13(17,18)19/h2-6H,1H3,(H2,20,22) |
| InChIKey | IKQUDHWBKVIBRN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|