C17H14F3N5 — CID 168631069
4-methyl-1-[[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]imidazol-2-amine (PubChem CID 168631069) has the molecular formula C17H14F3N5 and a molecular weight of 345.33 g/mol. Its IUPAC name is 4-methyl-1-[[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168631069 |
| Molecular Formula | C17H14F3N5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-methyl-1-[[4-[4-(trifluoromethyl)-2-pyridinyl]phenyl]methylideneamino]imidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(-c3cc(C(F)(F)F)ccn3)cc2)c(N)n1 |
| InChI | InChI=1S/C17H14F3N5/c1-11-10-25(16(21)24-11)23-9-12-2-4-13(5-3-12)15-8-14(6-7-22-15)17(18,19)20/h2-10H,1H3,(H2,21,24) |
| InChIKey | DGXNUVQGTRWRJY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|