C11H11BF3N4- — CID 168628704
[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]-trifluoroboranuide (PubChem CID 168628704) has the molecular formula C11H11BF3N4- and a molecular weight of 267.04 g/mol. Its IUPAC name is [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]-trifluoroboranuide.
| Compound Name | [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 168628704 |
| Molecular Formula | C11H11BF3N4- |
| Molecular Weight | 267.04 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]phenyl]-trifluoroboranuide |
| SMILES | Cc1cn(N=Cc2ccc([B-](F)(F)F)cc2)c(N)n1 |
| InChI | InChI=1S/C11H11BF3N4/c1-8-7-19(11(16)18-8)17-6-9-2-4-10(5-3-9)12(13,14)15/h2-7H,1H3,(H2,16,18)/q-1 |
| InChIKey | LECZUADVYUBTOW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.04 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|