C16H16N6O — CID 168631115
4-methyl-1-[[4-(6-methylpyrazin-2-yl)oxyphenyl]methylideneamino]imidazol-2-amine (PubChem CID 168631115) has the molecular formula C16H16N6O and a molecular weight of 308.35 g/mol. Its IUPAC name is 4-methyl-1-[[4-(6-methylpyrazin-2-yl)oxyphenyl]methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[[4-(6-methylpyrazin-2-yl)oxyphenyl]methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168631115 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-methyl-1-[[4-(6-methylpyrazin-2-yl)oxyphenyl]methylideneamino]imidazol-2-amine |
| SMILES | Cc1cncc(Oc2ccc(C=Nn3cc(C)nc3N)cc2)n1 |
| InChI | InChI=1S/C16H16N6O/c1-11-7-18-9-15(20-11)23-14-5-3-13(4-6-14)8-19-22-10-12(2)21-16(22)17/h3-10H,1-2H3,(H2,17,21) |
| InChIKey | GSHSFJHTDGIBOG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|