C12H12BF3N4O2 — CID 168629703
[4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-3-(trifluoromethyl)phenyl]boronic acid (PubChem CID 168629703) has the molecular formula C12H12BF3N4O2 and a molecular weight of 312.06 g/mol. Its IUPAC name is [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-3-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-3-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 168629703 |
| Molecular Formula | C12H12BF3N4O2 |
| Molecular Weight | 312.06 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [4-[(2-amino-4-methylimidazol-1-yl)iminomethyl]-3-(trifluoromethyl)phenyl]boronic acid |
| SMILES | Cc1cn(N=Cc2ccc(B(O)O)cc2C(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C12H12BF3N4O2/c1-7-6-20(11(17)19-7)18-5-8-2-3-9(13(21)22)4-10(8)12(14,15)16/h2-6,21-22H,1H3,(H2,17,19) |
| InChIKey | DNVULHQSUSHULC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.06 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|